What is the structure of Propiophenone?

What is the structure of Propiophenone?

C9H10OPropiophenone / Formula

How do you analyze a mass spectra?

How to Read a Simple Mass Spectrum

  1. Step 1: Step 1: Identify the Molecular Ion.
  2. Step 2: Step 2: Identify Major Fragmentation Clusters.
  3. Step 3: Step 3: Determine the ∆m for Each Major Peak.
  4. Step 4: Step 4: Identify Any Heteroatoms.
  5. Step 5: Step 5: Identify Remainder of Molecule.
  6. Step 6: Step 6: Name the Molecule.

Is Propiophenone water soluble?

Propiophenone (shorthand: benzoylethane or BzEt) is an aryl ketone. It is a colorless, sweet-smelling liquid that is insoluble in water, but miscible with organic solvents. It is used in the preparation of other compounds.

Is Propiophenone polar?

Propiophenone is an aromatic ketone in which the two substituents on the carbonyl C atom are phenyl and ethyl. It has a role as a fragrance….3.2.13Kovats Retention Index.

Standard non-polar 1164, 1140, 1144, 1148.2
Standard polar 1744, 1696, 1734, 1737, 1682, 1712, 1715

What is Propiophenone used for?

Uses. Propiophenone is an aryl ketone used in the preparation of pharmaceutical and organic compounds. Propiophenone is used in perfumes as well as in the preparation of neurochemical compounds such as ephe drines.

What is propio in chemistry?

Propionic acid is composed from the two greek words protos which means “first”, and pion, which mean “fat” and it is also known as propanoic acid. Regards. This conversation is already closed by Expert. Copyright © 2022 Aakash EduTech Pvt.

What is the Iupac name of Propiophenone?

1-phenylpropan-1-one

IUPAC Name 1-phenylpropan-1-one
Alternative Names Propiophenone Ethyl phenyl ketone
Molecular Formula C9H10O
Molar Mass 134.178 g/mol
InChI InChI=1S/C9H10O/c1-2-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3

What is P2P drug used for?

Phenylacetone is an organic compound with the chemical formula C6H5CH2COCH3. It is a colorless oil that is soluble in organic solvents. This substance is used in the manufacture of methamphetamine and amphetamine, where it is commonly known as P2P.

What kind of chemical is P2P?

P2P is an abbreviated name for phenyl-2-propanone methamphetamine produced by combining two chemicals. Mixing these two chemicals creates phenyl-2-propane, which is similar to methamphetamine. Phenyl-2-propane is used to make other drugs, such as cocaine and amphetamine.

What type of drug is P2P?

What is P2P used for?

P2P, in full peer-to-peer, type of computer network often used for the distribution of digital media files. In a peer-to-peer (P2P) network, each computer acts as both a server and a client—supplying and receiving files—with bandwidth and processing distributed among all members of the network.

What is P2P liquid used for?

What is the molecular weight of propiophenone 7148?

Propiophenone PubChem CID 7148 Synonyms Propiophenone 93-55-0 1-phenylpropan-1-o Molecular Weight 134.17 Date s Modify 2021-07-10 Create 2005-03-26

What is the hazard rating for propiophenone?

The most severely injurious substances have been rated 10. Propiophenone is rated 1 on rabbit eyes. A case study for propiophenone (CAS # 93-55-0) was reported regarding a spill that occurred at Union Carbide Corp’s, South Charleston, West Virginia Plant.

What is propiophenone?

Propiophenone is an aromatic ketone in which the two substituents on the carbonyl C atom are phenyl and ethyl. It has a role as a fragrance. Computed by Lexichem TK 2.7.0 (PubChem release 2021.05.07) Computed by InChI 1.0.6 (PubChem release 2021.05.07)

What is the case study for propiophenone (CAS 93-55-0)?

A case study for propiophenone (CAS # 93-55-0) was reported regarding a spill that occurred at Union Carbide Corp’s, South Charleston, West Virginia Plant.